C27H50N2O2 — CID 91341451
(2R,3R,3aS,6aS)-5-[[3-[di(propan-2-yl)amino]propylamino]methyl]-3-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 91341451) has the molecular formula C27H50N2O2 and a molecular weight of 434.71 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[[3-[di(propan-2-yl)amino]propylamino]methyl]-3-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[[3-[di(propan-2-yl)amino]propylamino]methyl]-3-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 91341451 |
| Molecular Formula | C27H50N2O2 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.39 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[[3-[di(propan-2-yl)amino]propylamino]methyl]-3-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@](C)(O)CC=C[C@@H]1[C@H]2CC(CNCCCN(C(C)C)C(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H50N2O2/c1-7-8-12-27(6,31)13-9-11-24-25-17-22(16-23(25)18-26(24)30)19-28-14-10-15-29(20(2)3)21(4)5/h9,11,16,20-21,23-26,28,30-31H,7-8,10,12-15,17-19H2,1-6H3/t23-,24+,25-,26+,27-/m0/s1 |
| InChIKey | KUZONEAFLCZOKO-HYFAGJRRSA-N |
| XLogP | 4.92 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|