C22H37NO4 — CID 91099141
2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-N,N-dimethylacetamide (PubChem CID 91099141) has the molecular formula C22H37NO4 and a molecular weight of 379.54 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 91099141 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-N,N-dimethylacetamide |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1[C@H]2CC(CCOCC(=O)N(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C22H37NO4/c1-4-5-6-7-18(24)8-9-19-20-13-16(12-17(20)14-21(19)25)10-11-27-15-22(26)23(2)3/h8-9,12,17-21,24-25H,4-7,10-11,13-15H2,1-3H3/t17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | OPRDUYKXRQSLKV-JRSUCEMESA-N |
| XLogP | 2.92 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|