C27H40O6 — CID 68748877
2-[2-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-(4-methylphenoxy)but-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid (PubChem CID 68748877) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is 2-[2-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-(4-methylphenoxy)but-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid.
| Compound Name | 2-[2-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-(4-methylphenoxy)but-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
|---|---|
| PubChem CID | 68748877 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 2-[2-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-(4-methylphenoxy)but-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
| SMILES | CCCC(CC[C@@H]1CC[C@@H]2[C@@H](/C=C/[C@@H](O)COc3ccc(C)cc3)[C@H](O)C[C@@H]2OC1)C(=O)O |
| InChI | InChI=1S/C27H40O6/c1-3-4-20(27(30)31)9-7-19-8-13-24-23(25(29)15-26(24)33-16-19)14-10-21(28)17-32-22-11-5-18(2)6-12-22/h5-6,10-12,14,19-21,23-26,28-29H,3-4,7-9,13,15-17H2,1-2H3,(H,30,31)/b14-10+/t19-,20?,21-,23-,24-,25-,26+/m1/s1 |
| InChIKey | RWNUKMNVYOKZIY-CABVNDLSSA-N |
| XLogP | 4.36 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|