C25H34ClFO7 — CID 68750088
2-[[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-chloro-4-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]-3-methylbutanoic acid (PubChem CID 68750088) has the molecular formula C25H34ClFO7 and a molecular weight of 500.99 g/mol. Its IUPAC name is 2-[[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-chloro-4-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]-3-methylbutanoic acid.
| Compound Name | 2-[[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-chloro-4-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 68750088 |
| Molecular Formula | C25H34ClFO7 |
| Molecular Weight | 500.99 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 2-[[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-chloro-4-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]-3-methylbutanoic acid |
| SMILES | CC(C)C(OC[C@@H]1CC[C@@H]2[C@@H](/C=C/[C@@H](O)COc3ccc(F)c(Cl)c3)[C@H](O)C[C@@H]2OC1)C(=O)O |
| InChI | InChI=1S/C25H34ClFO7/c1-14(2)24(25(30)31)34-12-15-3-6-19-18(22(29)10-23(19)33-11-15)7-4-16(28)13-32-17-5-8-21(27)20(26)9-17/h4-5,7-9,14-16,18-19,22-24,28-29H,3,6,10-13H2,1-2H3,(H,30,31)/b7-4+/t15-,16-,18-,19-,22-,23+,24?/m1/s1 |
| InChIKey | UPNMZSPPHFPJGG-OLSRNNJYSA-N |
| XLogP | 3.69 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.99 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|