C23H31ClO6 — CID 68750783
4-[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid (PubChem CID 68750783) has the molecular formula C23H31ClO6 and a molecular weight of 438.95 g/mol. Its IUPAC name is 4-[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid.
| Compound Name | 4-[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 68750783 |
| Molecular Formula | C23H31ClO6 |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 4-[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@@H]1CC[C@@H]2[C@@H](/C=C/[C@@H](O)COc3cccc(Cl)c3)[C@H](O)C[C@@H]2OC1 |
| InChI | InChI=1S/C23H31ClO6/c24-16-4-2-5-18(11-16)29-14-17(25)8-10-19-20-9-7-15(3-1-6-23(27)28)13-30-22(20)12-21(19)26/h2,4-5,8,10-11,15,17,19-22,25-26H,1,3,6-7,9,12-14H2,(H,27,28)/b10-8+/t15-,17-,19-,20-,21-,22+/m1/s1 |
| InChIKey | JPAVFSHCMPMDJG-MKCDYGBLSA-N |
| XLogP | 3.68 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|