C25H35FO7 — CID 68746863
2-[[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]-3-methylbutanoic acid (PubChem CID 68746863) has the molecular formula C25H35FO7 and a molecular weight of 466.55 g/mol. Its IUPAC name is 2-[[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]-3-methylbutanoic acid.
| Compound Name | 2-[[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 68746863 |
| Molecular Formula | C25H35FO7 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-[[(3R,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]-3-methylbutanoic acid |
| SMILES | CC(C)C(OC[C@@H]1CC[C@@H]2[C@@H](/C=C/[C@@H](O)COc3cccc(F)c3)[C@H](O)C[C@@H]2OC1)C(=O)O |
| InChI | InChI=1S/C25H35FO7/c1-15(2)24(25(29)30)33-13-16-6-8-21-20(22(28)11-23(21)32-12-16)9-7-18(27)14-31-19-5-3-4-17(26)10-19/h3-5,7,9-10,15-16,18,20-24,27-28H,6,8,11-14H2,1-2H3,(H,29,30)/b9-7+/t16-,18-,20-,21-,22-,23+,24?/m1/s1 |
| InChIKey | XFYAGBZJTAFJKD-QRHCEZTMSA-N |
| XLogP | 3.04 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|