C31H46O6 — CID 68748821
propan-2-yl 4-[(3S,5aR,6R,7R,8aS)-7-(oxan-2-yloxy)-6-[(E)-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate (PubChem CID 68748821) has the molecular formula C31H46O6 and a molecular weight of 514.70 g/mol. Its IUPAC name is propan-2-yl 4-[(3S,5aR,6R,7R,8aS)-7-(oxan-2-yloxy)-6-[(E)-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate.
| Compound Name | propan-2-yl 4-[(3S,5aR,6R,7R,8aS)-7-(oxan-2-yloxy)-6-[(E)-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate |
|---|---|
| PubChem CID | 68748821 |
| Molecular Formula | C31H46O6 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | propan-2-yl 4-[(3S,5aR,6R,7R,8aS)-7-(oxan-2-yloxy)-6-[(E)-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate |
| SMILES | CC(C)OC(=O)CCC[C@H]1CC[C@@H]2[C@@H](/C=C/CCOc3ccccc3)[C@H](OC3CCCCO3)C[C@@H]2OC1 |
| InChI | InChI=1S/C31H46O6/c1-23(2)36-30(32)15-10-11-24-17-18-27-26(14-6-8-19-33-25-12-4-3-5-13-25)29(21-28(27)35-22-24)37-31-16-7-9-20-34-31/h3-6,12-14,23-24,26-29,31H,7-11,15-22H2,1-2H3/b14-6+/t24-,26+,27+,28-,29+,31?/m0/s1 |
| InChIKey | YRJWKMNAGUQILN-RUVAYVLMSA-N |
| XLogP | 6.48 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|