C33H46BrClO8 — CID 70530789
methyl 5-[(3aR,4R,5R,6aR)-4-[(E,3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate (PubChem CID 70530789) has the molecular formula C33H46BrClO8 and a molecular weight of 686.08 g/mol. Its IUPAC name is methyl 5-[(3aR,4R,5R,6aR)-4-[(E,3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate.
| Compound Name | methyl 5-[(3aR,4R,5R,6aR)-4-[(E,3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate |
|---|---|
| PubChem CID | 70530789 |
| Molecular Formula | C33H46BrClO8 |
| Molecular Weight | 686.08 g/mol |
| Exact Mass | 684.21 |
| IUPAC Name | methyl 5-[(3aR,4R,5R,6aR)-4-[(E,3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate |
| SMILES | COC(=O)CCCC(Br)C1C[C@@H]2[C@@H](/C=C/[C@H](COc3cccc(Cl)c3)OC3CCCCO3)[C@H](OC3CCCCO3)C[C@H]2O1 |
| InChI | InChI=1S/C33H46BrClO8/c1-37-31(36)11-7-10-27(34)30-19-26-25(28(20-29(26)42-30)43-33-13-3-5-17-39-33)15-14-24(41-32-12-2-4-16-38-32)21-40-23-9-6-8-22(35)18-23/h6,8-9,14-15,18,24-30,32-33H,2-5,7,10-13,16-17,19-21H2,1H3/b15-14+/t24-,25-,26-,27?,28-,29-,30?,32?,33?/m1/s1 |
| InChIKey | TXXUSJACYTZLEE-INONFJJPSA-N |
| XLogP | 7.00 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.08 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|