C31H50O7 — CID 86738984
methyl (E)-5-[(3aR,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoate (PubChem CID 86738984) has the molecular formula C31H50O7 and a molecular weight of 534.73 g/mol. Its IUPAC name is methyl (E)-5-[(3aR,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoate.
| Compound Name | methyl (E)-5-[(3aR,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 86738984 |
| Molecular Formula | C31H50O7 |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | methyl (E)-5-[(3aR,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H]2CC(/C=C/CCC(=O)OC)O[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C31H50O7/c1-3-4-5-12-23(37-30-15-8-10-19-34-30)17-18-25-26-21-24(13-6-7-14-29(32)33-2)36-28(26)22-27(25)38-31-16-9-11-20-35-31/h6,13,17-18,23-28,30-31H,3-5,7-12,14-16,19-22H2,1-2H3/b13-6+,18-17+/t23-,24?,25+,26+,27+,28-,30?,31?/m0/s1 |
| InChIKey | OAVZQTVHWWXJAB-TUVSCWNBSA-N |
| XLogP | 6.25 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|