C26H44O6 — CID 67906955
(3aR,4R,5R,6aS)-4-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 67906955) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 67906955 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(C)[C@@H](/C=C/[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C26H44O6/c1-3-4-9-18(2)21(31-25-10-5-7-14-28-25)13-12-19-20-16-24(27)30-23(20)17-22(19)32-26-11-6-8-15-29-26/h12-13,18-27H,3-11,14-17H2,1-2H3/b13-12+/t18?,19-,20-,21-,22-,23+,24?,25?,26?/m1/s1 |
| InChIKey | VCGPYNGQFGLBCD-ZZEMHZIJSA-N |
| XLogP | 4.94 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|