C32H53BrO6 — CID 56615098
methyl 7-[(1R,2R,3R,5S)-5-bromo-2-[(3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 56615098) has the molecular formula C32H53BrO6 and a molecular weight of 613.67 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-bromo-2-[(3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-bromo-2-[(3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 56615098 |
| Molecular Formula | C32H53BrO6 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-bromo-2-[(3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCCCC(C)[C@@H](C=C[C@@H]1[C@@H](CC=CCCCC(=O)OC)[C@@H](Br)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C32H53BrO6/c1-4-5-14-24(2)28(38-31-17-10-12-21-36-31)20-19-26-25(15-8-6-7-9-16-30(34)35-3)27(33)23-29(26)39-32-18-11-13-22-37-32/h6,8,19-20,24-29,31-32H,4-5,7,9-18,21-23H2,1-3H3/t24?,25-,26-,27+,28-,29-,31?,32?/m1/s1 |
| InChIKey | QOTUNNLGMNJMRJ-MBUKZOFISA-N |
| XLogP | 7.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|