C35H56O8 — CID 88735860
methyl (Z)-7-[(1R,2R,3R,5R)-2-[(E,3R)-3-(1-butylcyclobutyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-formyloxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 88735860) has the molecular formula C35H56O8 and a molecular weight of 604.83 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5R)-2-[(E,3R)-3-(1-butylcyclobutyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-formyloxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5R)-2-[(E,3R)-3-(1-butylcyclobutyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-formyloxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 88735860 |
| Molecular Formula | C35H56O8 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5R)-2-[(E,3R)-3-(1-butylcyclobutyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-formyloxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCCCC1([C@@H](/C=C/[C@@H]2[C@@H](C/C=C\CCCC(=O)OC)[C@H](OC=O)C[C@H]2OC2CCCCO2)OC2CCCCO2)CCC1 |
| InChI | InChI=1S/C35H56O8/c1-3-4-20-35(21-13-22-35)31(43-34-17-10-12-24-40-34)19-18-28-27(14-7-5-6-8-15-32(37)38-2)29(41-26-36)25-30(28)42-33-16-9-11-23-39-33/h5,7,18-19,26-31,33-34H,3-4,6,8-17,20-25H2,1-2H3/b7-5-,19-18+/t27-,28-,29-,30-,31-,33?,34?/m1/s1 |
| InChIKey | IYPNQOHAFLFNEV-RUIWFTFUSA-N |
| XLogP | 7.19 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|