C32H50O7 — CID 70550373
methyl (Z)-7-[(1R,2R,3R,5R)-5-hydroxy-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 70550373) has the molecular formula C32H50O7 and a molecular weight of 546.75 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5R)-5-hydroxy-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5R)-5-hydroxy-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70550373 |
| Molecular Formula | C32H50O7 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5R)-5-hydroxy-2-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CC#CCC(C)[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@H](O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C32H50O7/c1-4-5-14-24(2)28(38-31-17-10-12-21-36-31)20-19-26-25(15-8-6-7-9-16-30(34)35-3)27(33)23-29(26)39-32-18-11-13-22-37-32/h6,8,19-20,24-29,31-33H,7,9-18,21-23H2,1-3H3/b8-6-,20-19+/t24?,25-,26-,27-,28-,29-,31?,32?/m1/s1 |
| InChIKey | VCAKMRHJGPQCCW-RUJYSKPUSA-N |
| XLogP | 5.70 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|