C27H44O6 — CID 156904814
(1S,2S,3R,4R)-2-(2-hydroxyethyl)-3-[(E,3S,4S)-4-methyl-3-[(2S)-oxan-2-yl]oxynon-1-en-6-ynyl]-4-(oxan-2-yloxy)cyclopentan-1-ol (PubChem CID 156904814) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is (1S,2S,3R,4R)-2-(2-hydroxyethyl)-3-[(E,3S,4S)-4-methyl-3-[(2S)-oxan-2-yl]oxynon-1-en-6-ynyl]-4-(oxan-2-yloxy)cyclopentan-1-ol.
| Compound Name | (1S,2S,3R,4R)-2-(2-hydroxyethyl)-3-[(E,3S,4S)-4-methyl-3-[(2S)-oxan-2-yl]oxynon-1-en-6-ynyl]-4-(oxan-2-yloxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 156904814 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (1S,2S,3R,4R)-2-(2-hydroxyethyl)-3-[(E,3S,4S)-4-methyl-3-[(2S)-oxan-2-yl]oxynon-1-en-6-ynyl]-4-(oxan-2-yloxy)cyclopentan-1-ol |
| SMILES | CCC#CC[C@H](C)[C@@H](/C=C/[C@@H]1[C@H](CCO)[C@@H](O)C[C@H]1OC1CCCCO1)O[C@H]1CCCCO1 |
| InChI | InChI=1S/C27H44O6/c1-3-4-5-10-20(2)24(32-26-11-6-8-17-30-26)14-13-22-21(15-16-28)23(29)19-25(22)33-27-12-7-9-18-31-27/h13-14,20-29H,3,6-12,15-19H2,1-2H3/b14-13+/t20-,21-,22+,23-,24+,25+,26-,27?/m0/s1 |
| InChIKey | MLCFXAUREAHDSZ-JFIJDWLESA-N |
| XLogP | 4.19 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|