C34H64F2O4Si — CID 59958193
(3R)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodec-1-enyl]-2-octyl-4-(oxan-2-yloxy)cyclopentan-1-ol (PubChem CID 59958193) has the molecular formula C34H64F2O4Si and a molecular weight of 602.96 g/mol. Its IUPAC name is (3R)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodec-1-enyl]-2-octyl-4-(oxan-2-yloxy)cyclopentan-1-ol.
| Compound Name | (3R)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodec-1-enyl]-2-octyl-4-(oxan-2-yloxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 59958193 |
| Molecular Formula | C34H64F2O4Si |
| Molecular Weight | 602.96 g/mol |
| Exact Mass | 602.45 |
| IUPAC Name | (3R)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodec-1-enyl]-2-octyl-4-(oxan-2-yloxy)cyclopentan-1-ol |
| SMILES | CCCCCCCCC1C(O)CC(OC2CCCCO2)[C@@H]1/C=C/C(O[Si](C)(C)C(C)(C)C)C(F)(F)CCCCCC |
| InChI | InChI=1S/C34H64F2O4Si/c1-8-10-12-14-15-16-20-27-28(30(26-29(27)37)39-32-21-17-19-25-38-32)22-23-31(40-41(6,7)33(3,4)5)34(35,36)24-18-13-11-9-2/h22-23,27-32,37H,8-21,24-26H2,1-7H3/b23-22+/t27?,28-,29?,30?,31?,32?/m1/s1 |
| InChIKey | UIRHRTFCEIFLHQ-SJMKPUFKSA-N |
| XLogP | 10.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.96 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|