C33H56O7 — CID 13273339
7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(1E,3R)-4,4,7-trimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]cyclopentyl]heptanoic acid (PubChem CID 13273339) has the molecular formula C33H56O7 and a molecular weight of 564.80 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(1E,3R)-4,4,7-trimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(1E,3R)-4,4,7-trimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 13273339 |
| Molecular Formula | C33H56O7 |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(1E,3R)-4,4,7-trimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]cyclopentyl]heptanoic acid |
| SMILES | CC(C)=CCC(C)(C)[C@@H](/C=C/[C@@H]1[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C33H56O7/c1-24(2)19-20-33(3,4)29(40-32-16-10-12-22-38-32)18-17-26-25(13-7-5-6-8-14-30(35)36)27(34)23-28(26)39-31-15-9-11-21-37-31/h17-19,25-29,31-32,34H,5-16,20-23H2,1-4H3,(H,35,36)/b18-17+/t25-,26-,27+,28-,29-,31?,32?/m1/s1 |
| InChIKey | XDZOXCZEIBPZHK-CQXWGIJFSA-N |
| XLogP | 7.17 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|