C34H56O8 — CID 70423512
7-[(1R,2R,3R,5S)-2-[(E,3S)-3-[(1S,3S)-3-butylcyclopentyl]-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-6-oxoheptanoic acid (PubChem CID 70423512) has the molecular formula C34H56O8 and a molecular weight of 592.81 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(E,3S)-3-[(1S,3S)-3-butylcyclopentyl]-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-6-oxoheptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(E,3S)-3-[(1S,3S)-3-butylcyclopentyl]-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 70423512 |
| Molecular Formula | C34H56O8 |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(E,3S)-3-[(1S,3S)-3-butylcyclopentyl]-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-6-oxoheptanoic acid |
| SMILES | CCCC[C@H]1CC[C@H]([C@@H](/C=C/[C@@H]2[C@@H](CC(=O)CCCCC(=O)O)[C@@H](O)C[C@H]2OC2CCCCO2)OC2CCCCO2)C1 |
| InChI | InChI=1S/C34H56O8/c1-2-3-10-24-15-16-25(21-24)30(41-33-13-6-8-19-39-33)18-17-27-28(22-26(35)11-4-5-12-32(37)38)29(36)23-31(27)42-34-14-7-9-20-40-34/h17-18,24-25,27-31,33-34,36H,2-16,19-23H2,1H3,(H,37,38)/b18-17+/t24-,25-,27+,28+,29-,30+,31+,33?,34?/m0/s1 |
| InChIKey | MOEJOXOQZRVTLI-KOVFWUTPSA-N |
| XLogP | 6.57 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|