C33H54O6 — CID 88728745
(Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentyl]hept-5-enal (PubChem CID 88728745) has the molecular formula C33H54O6 and a molecular weight of 546.79 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentyl]hept-5-enal.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentyl]hept-5-enal |
|---|---|
| PubChem CID | 88728745 |
| Molecular Formula | C33H54O6 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentyl]hept-5-enal |
| SMILES | CCCC1CCC([C@@H](/C=C/[C@@H]2[C@@H](C/C=C\CCCC=O)[C@@H](OC3CCCCO3)C[C@H]2O)OC2CCCCO2)C1 |
| InChI | InChI=1S/C33H54O6/c1-2-12-25-16-17-26(23-25)30(38-32-14-7-10-21-36-32)19-18-27-28(13-6-4-3-5-9-20-34)31(24-29(27)35)39-33-15-8-11-22-37-33/h4,6,18-20,25-33,35H,2-3,5,7-17,21-24H2,1H3/b6-4-,19-18+/t25?,26?,27-,28-,29-,30-,31+,32?,33?/m1/s1 |
| InChIKey | NDZJGEAUZNXFGY-VSJJRKLRSA-N |
| XLogP | 6.90 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|