C29H48O7 — CID 70510370
5-[(3aR,4R,5R,6aR)-5-hydroxy-2-methoxy-4-[(E,3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-yl]pentanoic acid (PubChem CID 70510370) has the molecular formula C29H48O7 and a molecular weight of 508.70 g/mol. Its IUPAC name is 5-[(3aR,4R,5R,6aR)-5-hydroxy-2-methoxy-4-[(E,3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-yl]pentanoic acid.
| Compound Name | 5-[(3aR,4R,5R,6aR)-5-hydroxy-2-methoxy-4-[(E,3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 70510370 |
| Molecular Formula | C29H48O7 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | 5-[(3aR,4R,5R,6aR)-5-hydroxy-2-methoxy-4-[(E,3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-yl]pentanoic acid |
| SMILES | CCCC1CCC([C@@H](/C=C/[C@@H]2[C@H]3CC(CCCCC(=O)O)(OC)O[C@@H]3C[C@H]2O)OC2CCCCO2)C1 |
| InChI | InChI=1S/C29H48O7/c1-3-8-20-11-12-21(17-20)25(35-28-10-5-7-16-34-28)14-13-22-23-19-29(33-2,15-6-4-9-27(31)32)36-26(23)18-24(22)30/h13-14,20-26,28,30H,3-12,15-19H2,1-2H3,(H,31,32)/b14-13+/t20?,21?,22-,23-,24-,25-,26-,28?,29?/m1/s1 |
| InChIKey | CZFCDCGBBCNLTG-ZRDBWOJQSA-N |
| XLogP | 5.44 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|