C33H54O7 — CID 70606698
methyl (E)-7-[(1R,2R,3R,5S)-2-[(E,3S)-3-(3-ethylcyclopentyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-2-enoate (PubChem CID 70606698) has the molecular formula C33H54O7 and a molecular weight of 562.79 g/mol. Its IUPAC name is methyl (E)-7-[(1R,2R,3R,5S)-2-[(E,3S)-3-(3-ethylcyclopentyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-2-enoate.
| Compound Name | methyl (E)-7-[(1R,2R,3R,5S)-2-[(E,3S)-3-(3-ethylcyclopentyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 70606698 |
| Molecular Formula | C33H54O7 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | methyl (E)-7-[(1R,2R,3R,5S)-2-[(E,3S)-3-(3-ethylcyclopentyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-2-enoate |
| SMILES | CCC1CCC([C@@H](/C=C/[C@@H]2[C@@H](CCCC/C=C/C(=O)OC)[C@@H](O)C[C@H]2OC2CCCCO2)OC2CCCCO2)C1 |
| InChI | InChI=1S/C33H54O7/c1-3-24-16-17-25(22-24)29(39-32-14-8-10-20-37-32)19-18-27-26(12-6-4-5-7-13-31(35)36-2)28(34)23-30(27)40-33-15-9-11-21-38-33/h7,13,18-19,24-30,32-34H,3-6,8-12,14-17,20-23H2,1-2H3/b13-7+,19-18+/t24?,25?,26-,27-,28+,29-,30-,32?,33?/m1/s1 |
| InChIKey | VJTJSSHZZOBWJX-NFXDNMRYSA-N |
| XLogP | 6.48 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|