C33H50O7 — CID 56617019
7-[(1R,2R,5S)-5-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]-3-oxocyclopentyl]hepta-2,5-dienoic acid (PubChem CID 56617019) has the molecular formula C33H50O7 and a molecular weight of 558.76 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-5-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]-3-oxocyclopentyl]hepta-2,5-dienoic acid.
| Compound Name | 7-[(1R,2R,5S)-5-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]-3-oxocyclopentyl]hepta-2,5-dienoic acid |
|---|---|
| PubChem CID | 56617019 |
| Molecular Formula | C33H50O7 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | 7-[(1R,2R,5S)-5-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-3-(3-propylcyclopentyl)prop-1-enyl]-3-oxocyclopentyl]hepta-2,5-dienoic acid |
| SMILES | CCCC1CCC([C@@H](C=C[C@H]2C(=O)C[C@H](OC3CCCCO3)[C@@H]2CC=CCC=CC(=O)O)OC2CCCCO2)C1 |
| InChI | InChI=1S/C33H50O7/c1-2-11-24-16-17-25(22-24)29(39-32-14-7-9-20-37-32)19-18-26-27(12-5-3-4-6-13-31(35)36)30(23-28(26)34)40-33-15-8-10-21-38-33/h3,5-6,13,18-19,24-27,29-30,32-33H,2,4,7-12,14-17,20-23H2,1H3,(H,35,36)/t24?,25?,26-,27-,29-,30+,32?,33?/m1/s1 |
| InChIKey | XFGMHPXHZFOKJR-BSLRCNMWSA-N |
| XLogP | 6.76 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|