C24H38O5 — CID 70517957
(2R,3R,4S)-4-hydroxy-3-[(Z)-8-hydroxy-7-oxooct-2-enyl]-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentan-1-one (PubChem CID 70517957) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is (2R,3R,4S)-4-hydroxy-3-[(Z)-8-hydroxy-7-oxooct-2-enyl]-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4S)-4-hydroxy-3-[(Z)-8-hydroxy-7-oxooct-2-enyl]-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70517957 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | (2R,3R,4S)-4-hydroxy-3-[(Z)-8-hydroxy-7-oxooct-2-enyl]-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]cyclopentan-1-one |
| SMILES | CCCC1CCC([C@H](O)/C=C/[C@H]2C(=O)C[C@H](O)[C@@H]2C/C=C\CCCC(=O)CO)C1 |
| InChI | InChI=1S/C24H38O5/c1-2-7-17-10-11-18(14-17)22(27)13-12-21-20(23(28)15-24(21)29)9-6-4-3-5-8-19(26)16-25/h4,6,12-13,17-18,20-23,25,27-28H,2-3,5,7-11,14-16H2,1H3/b6-4-,13-12+/t17?,18?,20-,21-,22-,23+/m1/s1 |
| InChIKey | LPQFYCRCMVQYIJ-BYMVTPRVSA-N |
| XLogP | 3.36 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|