C25H40O6 — CID 70464290
1-[(1R,2R,3R)-2-[(3S)-3-(3-butylcyclopentyl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]-8-hydroxyoctane-2,7-dione (PubChem CID 70464290) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is 1-[(1R,2R,3R)-2-[(3S)-3-(3-butylcyclopentyl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]-8-hydroxyoctane-2,7-dione.
| Compound Name | 1-[(1R,2R,3R)-2-[(3S)-3-(3-butylcyclopentyl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]-8-hydroxyoctane-2,7-dione |
|---|---|
| PubChem CID | 70464290 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 1-[(1R,2R,3R)-2-[(3S)-3-(3-butylcyclopentyl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]-8-hydroxyoctane-2,7-dione |
| SMILES | CCCCC1CCC([C@H](O)C=C[C@H]2[C@H](O)CC(=O)[C@@H]2CC(=O)CCCCC(=O)CO)C1 |
| InChI | InChI=1S/C25H40O6/c1-2-3-6-17-9-10-18(13-17)23(29)12-11-21-22(25(31)15-24(21)30)14-19(27)7-4-5-8-20(28)16-26/h11-12,17-18,21-24,26,29-30H,2-10,13-16H2,1H3/t17?,18?,21-,22-,23-,24-/m1/s1 |
| InChIKey | WUCIOKDYSVOXQX-RNPMEAHTSA-N |
| XLogP | 3.16 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|