C22H36O4 — CID 70626088
(2R,3R,4R)-3-[(E,3S)-3-(3-bicyclo[3.2.0]heptanyl)-3-hydroxyprop-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one (PubChem CID 70626088) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (2R,3R,4R)-3-[(E,3S)-3-(3-bicyclo[3.2.0]heptanyl)-3-hydroxyprop-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-[(E,3S)-3-(3-bicyclo[3.2.0]heptanyl)-3-hydroxyprop-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 70626088 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (2R,3R,4R)-3-[(E,3S)-3-(3-bicyclo[3.2.0]heptanyl)-3-hydroxyprop-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one |
| SMILES | O=C1C[C@@H](O)[C@H](/C=C/[C@@H](O)C2CC3CCC3C2)[C@H]1CCCCCCCO |
| InChI | InChI=1S/C22H36O4/c23-11-5-3-1-2-4-6-18-19(22(26)14-21(18)25)9-10-20(24)17-12-15-7-8-16(15)13-17/h9-10,15-20,22-24,26H,1-8,11-14H2/b10-9+/t15?,16?,17?,18-,19-,20-,22-/m1/s1 |
| InChIKey | DKKTWTYEUIKWMR-QFARGJOASA-N |
| XLogP | 3.24 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|