C23H40O4 — CID 22812175
(2R,3R,4R)-3-[(E,3S)-3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one (PubChem CID 22812175) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is (2R,3R,4R)-3-[(E,3S)-3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-[(E,3S)-3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 22812175 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (2R,3R,4R)-3-[(E,3S)-3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one |
| SMILES | CCCCC1([C@@H](O)/C=C/[C@H]2[C@H](O)CC(=O)[C@@H]2CCCCCCCO)CCC1 |
| InChI | InChI=1S/C23H40O4/c1-2-3-13-23(14-9-15-23)22(27)12-11-19-18(20(25)17-21(19)26)10-7-5-4-6-8-16-24/h11-12,18-19,21-22,24,26-27H,2-10,13-17H2,1H3/b12-11+/t18-,19-,21-,22+/m1/s1 |
| InChIKey | ITYUULAHYVBLFN-IBLRFTBGSA-N |
| XLogP | 4.16 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|