C21H38O4 — CID 22820291
(2R,3R,4R)-4-hydroxy-2-(7-hydroxyheptyl)-3-[(E)-4-hydroxy-5-methyloct-1-enyl]cyclopentan-1-one (PubChem CID 22820291) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is (2R,3R,4R)-4-hydroxy-2-(7-hydroxyheptyl)-3-[(E)-4-hydroxy-5-methyloct-1-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-hydroxy-2-(7-hydroxyheptyl)-3-[(E)-4-hydroxy-5-methyloct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 22820291 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (2R,3R,4R)-4-hydroxy-2-(7-hydroxyheptyl)-3-[(E)-4-hydroxy-5-methyloct-1-enyl]cyclopentan-1-one |
| SMILES | CCCC(C)C(O)C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCCO |
| InChI | InChI=1S/C21H38O4/c1-3-10-16(2)19(23)13-9-12-18-17(20(24)15-21(18)25)11-7-5-4-6-8-14-22/h9,12,16-19,21-23,25H,3-8,10-11,13-15H2,1-2H3/b12-9+/t16?,17-,18-,19?,21-/m1/s1 |
| InChIKey | YDRRRXVXSMEHLP-QOXTWVRHSA-N |
| XLogP | 3.63 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|