C23H40O5S — CID 57242752
7-[(1R,2R,3R)-3-(2-hydroxyethylsulfanyl)-2-(4-hydroxy-5-methyloct-1-enyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 57242752) has the molecular formula C23H40O5S and a molecular weight of 428.64 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-3-(2-hydroxyethylsulfanyl)-2-(4-hydroxy-5-methyloct-1-enyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-3-(2-hydroxyethylsulfanyl)-2-(4-hydroxy-5-methyloct-1-enyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57242752 |
| Molecular Formula | C23H40O5S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 7-[(1R,2R,3R)-3-(2-hydroxyethylsulfanyl)-2-(4-hydroxy-5-methyloct-1-enyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCC(C)C(O)CC=C[C@H]1[C@H](SCCO)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C23H40O5S/c1-3-9-17(2)20(25)12-8-11-19-18(10-6-4-5-7-13-23(27)28)21(26)16-22(19)29-15-14-24/h8,11,17-20,22,24-25H,3-7,9-10,12-16H2,1-2H3,(H,27,28)/t17?,18-,19-,20?,22-/m1/s1 |
| InChIKey | YONFBCLUVXPVGQ-SPFHDNFTSA-N |
| XLogP | 4.45 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|