C24H40O5 — CID 57050180
ethyl 8-[(1R,2R)-2-(4-hydroxy-5-methyloct-1-enyl)-5-oxocyclopentyl]-2-oxooctanoate (PubChem CID 57050180) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is ethyl 8-[(1R,2R)-2-(4-hydroxy-5-methyloct-1-enyl)-5-oxocyclopentyl]-2-oxooctanoate.
| Compound Name | ethyl 8-[(1R,2R)-2-(4-hydroxy-5-methyloct-1-enyl)-5-oxocyclopentyl]-2-oxooctanoate |
|---|---|
| PubChem CID | 57050180 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | ethyl 8-[(1R,2R)-2-(4-hydroxy-5-methyloct-1-enyl)-5-oxocyclopentyl]-2-oxooctanoate |
| SMILES | CCCC(C)C(O)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)C(=O)OCC |
| InChI | InChI=1S/C24H40O5/c1-4-11-18(3)21(25)15-10-12-19-16-17-22(26)20(19)13-8-6-7-9-14-23(27)24(28)29-5-2/h10,12,18-21,25H,4-9,11,13-17H2,1-3H3/t18?,19-,20+,21?/m0/s1 |
| InChIKey | OCZKICJVLZGMBZ-RKDVLTNBSA-N |
| XLogP | 4.80 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|