C25H40O5 — CID 57138544
1-hydroxyethyl 3-ethenyl-8-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]-2-oxooctanoate (PubChem CID 57138544) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is 1-hydroxyethyl 3-ethenyl-8-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]-2-oxooctanoate.
| Compound Name | 1-hydroxyethyl 3-ethenyl-8-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]-2-oxooctanoate |
|---|---|
| PubChem CID | 57138544 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 1-hydroxyethyl 3-ethenyl-8-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]-2-oxooctanoate |
| SMILES | C=CC(CCCCC[C@H]1C(=O)CC[C@@H]1C=CCCCCCC)C(=O)C(=O)OC(C)O |
| InChI | InChI=1S/C25H40O5/c1-4-6-7-8-9-11-15-21-17-18-23(27)22(21)16-13-10-12-14-20(5-2)24(28)25(29)30-19(3)26/h5,11,15,19-22,26H,2,4,6-10,12-14,16-18H2,1,3H3/t19?,20?,21-,22+/m0/s1 |
| InChIKey | PACPUIRFZUFQJZ-QZNJRLLKSA-N |
| XLogP | 5.31 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|