C24H40O6 — CID 57263277
2-[hydroxy(2-hydroxypropoxy)methyl]-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoic acid (PubChem CID 57263277) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is 2-[hydroxy(2-hydroxypropoxy)methyl]-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 2-[hydroxy(2-hydroxypropoxy)methyl]-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57263277 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 2-[hydroxy(2-hydroxypropoxy)methyl]-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCC=CCCC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(C(=O)O)C(O)OCC(C)O |
| InChI | InChI=1S/C24H40O6/c1-3-4-5-6-7-9-12-19-15-16-22(26)20(19)13-10-8-11-14-21(23(27)28)24(29)30-17-18(2)25/h4-5,9,12,18-21,24-25,29H,3,6-8,10-11,13-17H2,1-2H3,(H,27,28)/t18?,19-,20+,21?,24?/m0/s1 |
| InChIKey | OPFIMCGROCJBTO-VRAWUHFASA-N |
| XLogP | 4.25 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|