C22H38O3 — CID 154412212
7-[(1R,2R)-2-[(E)-5,5-dimethyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 154412212) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(E)-5,5-dimethyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R)-2-[(E)-5,5-dimethyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 154412212 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 7-[(1R,2R)-2-[(E)-5,5-dimethyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCC(C)(C)CC/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H38O3/c1-4-16-22(2,3)17-10-9-11-18-14-15-20(23)19(18)12-7-5-6-8-13-21(24)25/h9,11,18-19H,4-8,10,12-17H2,1-3H3,(H,24,25)/b11-9+/t18-,19+/m0/s1 |
| InChIKey | QPHJLDQAUKPFEL-AYLUNBTKSA-N |
| XLogP | 6.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|