C23H32O3 — CID 18624017
7-[2-oxo-5-[(E)-2-(4-propylphenyl)ethenyl]cyclopentyl]heptanoic acid (PubChem CID 18624017) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 7-[2-oxo-5-[(E)-2-(4-propylphenyl)ethenyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[2-oxo-5-[(E)-2-(4-propylphenyl)ethenyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18624017 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 7-[2-oxo-5-[(E)-2-(4-propylphenyl)ethenyl]cyclopentyl]heptanoic acid |
| SMILES | CCCc1ccc(/C=C/C2CCC(=O)C2CCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C23H32O3/c1-2-7-18-10-12-19(13-11-18)14-15-20-16-17-22(24)21(20)8-5-3-4-6-9-23(25)26/h10-15,20-21H,2-9,16-17H2,1H3,(H,25,26)/b15-14+ |
| InChIKey | XQNXTLCNQORLCE-CCEZHUSRSA-N |
| XLogP | 5.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|