C21H28N2O4 — CID 70004254
7-[(1R,2R)-2-[2-[4-(carbamoylamino)phenyl]ethenyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 70004254) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[2-[4-(carbamoylamino)phenyl]ethenyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R)-2-[2-[4-(carbamoylamino)phenyl]ethenyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70004254 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 7-[(1R,2R)-2-[2-[4-(carbamoylamino)phenyl]ethenyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | NC(=O)Nc1ccc(C=C[C@H]2CCC(=O)[C@@H]2CCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H28N2O4/c22-21(27)23-17-12-8-15(9-13-17)7-10-16-11-14-19(24)18(16)5-3-1-2-4-6-20(25)26/h7-10,12-13,16,18H,1-6,11,14H2,(H,25,26)(H3,22,23,27)/t16-,18+/m0/s1 |
| InChIKey | CIUDNSFIJRITJF-FUHWJXTLSA-N |
| XLogP | 4.21 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|