C20H21ClF4O3 — CID 73454004
7-[2-[2-(4-chloro-2,3,5,6-tetrafluorophenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 73454004) has the molecular formula C20H21ClF4O3 and a molecular weight of 420.83 g/mol. Its IUPAC name is 7-[2-[2-(4-chloro-2,3,5,6-tetrafluorophenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[2-(4-chloro-2,3,5,6-tetrafluorophenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 73454004 |
| Molecular Formula | C20H21ClF4O3 |
| Molecular Weight | 420.83 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 7-[2-[2-(4-chloro-2,3,5,6-tetrafluorophenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CCC1C=Cc1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C20H21ClF4O3/c21-16-19(24)17(22)13(18(23)20(16)25)9-7-11-8-10-14(26)12(11)5-3-1-2-4-6-15(27)28/h7,9,11-12H,1-6,8,10H2,(H,27,28) |
| InChIKey | RNJVMLBHSUASBV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.83 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|