C27H30O4 — CID 18624052
7-[2-[(E)-2-(4-benzoylphenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 18624052) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is 7-[2-[(E)-2-(4-benzoylphenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[(E)-2-(4-benzoylphenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18624052 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 7-[2-[(E)-2-(4-benzoylphenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CCC1/C=C/c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H30O4/c28-25-19-18-21(24(25)10-6-1-2-7-11-26(29)30)15-12-20-13-16-23(17-14-20)27(31)22-8-4-3-5-9-22/h3-5,8-9,12-17,21,24H,1-2,6-7,10-11,18-19H2,(H,29,30)/b15-12+ |
| InChIKey | HZHAKZPNBJVJEU-NTCAYCPXSA-N |
| XLogP | 5.95 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|