C21H25FO4 — CID 70005857
7-[(1S,2S)-2-[3-(3-fluorophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 70005857) has the molecular formula C21H25FO4 and a molecular weight of 360.43 g/mol. Its IUPAC name is 7-[(1S,2S)-2-[3-(3-fluorophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2S)-2-[3-(3-fluorophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70005857 |
| Molecular Formula | C21H25FO4 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 7-[(1S,2S)-2-[3-(3-fluorophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1C(=O)CC[C@H]1C=CC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H25FO4/c22-17-7-5-6-16(14-17)19(23)12-10-15-11-13-20(24)18(15)8-3-1-2-4-9-21(25)26/h5-7,10,12,14-15,18H,1-4,8-9,11,13H2,(H,25,26)/t15-,18+/m1/s1 |
| InChIKey | AHDVQLXCMSYUCE-QAPCUYQASA-N |
| XLogP | 4.59 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|