C21H27FO3 — CID 70006393
7-[2-[2-(4-fluoro-3-methylphenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 70006393) has the molecular formula C21H27FO3 and a molecular weight of 346.44 g/mol. Its IUPAC name is 7-[2-[2-(4-fluoro-3-methylphenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[2-(4-fluoro-3-methylphenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70006393 |
| Molecular Formula | C21H27FO3 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 7-[2-[2-(4-fluoro-3-methylphenyl)ethenyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | Cc1cc(C=CC2CCC(=O)C2CCCCCCC(=O)O)ccc1F |
| InChI | InChI=1S/C21H27FO3/c1-15-14-16(9-12-19(15)22)8-10-17-11-13-20(23)18(17)6-4-2-3-5-7-21(24)25/h8-10,12,14,17-18H,2-7,11,13H2,1H3,(H,24,25) |
| InChIKey | PAIIOHZVLIDSMW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|