C21H24F2O4 — CID 18623941
7-[2-[(E)-3-(2,5-difluorophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 18623941) has the molecular formula C21H24F2O4 and a molecular weight of 378.42 g/mol. Its IUPAC name is 7-[2-[(E)-3-(2,5-difluorophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[(E)-3-(2,5-difluorophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18623941 |
| Molecular Formula | C21H24F2O4 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 7-[2-[(E)-3-(2,5-difluorophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CCC1/C=C/C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C21H24F2O4/c22-15-9-10-18(23)17(13-15)20(25)12-8-14-7-11-19(24)16(14)5-3-1-2-4-6-21(26)27/h8-10,12-14,16H,1-7,11H2,(H,26,27)/b12-8+ |
| InChIKey | NODZLVXFOGNKSH-XYOKQWHBSA-N |
| XLogP | 4.72 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|