C21H25NO6 — CID 70005649
7-[(1S,2S)-2-[3-(4-nitrophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 70005649) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is 7-[(1S,2S)-2-[3-(4-nitrophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2S)-2-[3-(4-nitrophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70005649 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 7-[(1S,2S)-2-[3-(4-nitrophenyl)-3-oxoprop-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1C(=O)CC[C@H]1C=CC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H25NO6/c23-19(16-7-11-17(12-8-16)22(27)28)13-9-15-10-14-20(24)18(15)5-3-1-2-4-6-21(25)26/h7-9,11-13,15,18H,1-6,10,14H2,(H,25,26)/t15-,18+/m1/s1 |
| InChIKey | IIXMXGZVQRCZQJ-QAPCUYQASA-N |
| XLogP | 4.35 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|