C21H25F3O3 — CID 70006918
7-[(1R,5R)-2-oxo-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]cyclopentyl]heptanoic acid (PubChem CID 70006918) has the molecular formula C21H25F3O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 7-[(1R,5R)-2-oxo-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,5R)-2-oxo-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70006918 |
| Molecular Formula | C21H25F3O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 7-[(1R,5R)-2-oxo-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1C(=O)CC[C@@H]1C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H25F3O3/c22-21(23,24)17-12-8-15(9-13-17)7-10-16-11-14-19(25)18(16)5-3-1-2-4-6-20(26)27/h7-10,12-13,16,18H,1-6,11,14H2,(H,26,27)/t16-,18+/m0/s1 |
| InChIKey | NCKOJPABJRZIFQ-FUHWJXTLSA-N |
| XLogP | 5.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|