C21H36O4 — CID 90673938
7-[(1R,2R)-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 90673938) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R)-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 90673938 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 7-[(1R,2R)-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCC(C)(O)C/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C21H36O4/c1-3-4-15-21(2,25)16-9-10-17-13-14-19(22)18(17)11-7-5-6-8-12-20(23)24/h9-10,17-18,25H,3-8,11-16H2,1-2H3,(H,23,24)/b10-9+/t17-,18+,21?/m0/s1 |
| InChIKey | HOHXBRMZBXKVJW-RGVZCXLKSA-N |
| XLogP | 4.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|