C20H29NO4S2 — CID 77223272
2-[2-[2-(4-hydroxy-4-methyloct-1-enyl)-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 77223272) has the molecular formula C20H29NO4S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-[2-[2-(4-hydroxy-4-methyloct-1-enyl)-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[2-(4-hydroxy-4-methyloct-1-enyl)-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 77223272 |
| Molecular Formula | C20H29NO4S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[2-[2-(4-hydroxy-4-methyloct-1-enyl)-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCC(C)(O)CC=CC1CCC(=O)C1CCSc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C20H29NO4S2/c1-3-4-10-20(2,25)11-5-6-14-7-8-17(22)15(14)9-12-26-19-21-16(13-27-19)18(23)24/h5-6,13-15,25H,3-4,7-12H2,1-2H3,(H,23,24) |
| InChIKey | MVWBRJCSHVIQES-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|