C22H29NO4S2 — CID 67082546
2-[2-[(1R,2R)-2-[(4R)-4-hydroxy-4-methyldec-1-en-5-ynyl]-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 67082546) has the molecular formula C22H29NO4S2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-[2-[(1R,2R)-2-[(4R)-4-hydroxy-4-methyldec-1-en-5-ynyl]-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(1R,2R)-2-[(4R)-4-hydroxy-4-methyldec-1-en-5-ynyl]-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67082546 |
| Molecular Formula | C22H29NO4S2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[2-[(1R,2R)-2-[(4R)-4-hydroxy-4-methyldec-1-en-5-ynyl]-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCC#C[C@](C)(O)CC=C[C@H]1CCC(=O)[C@@H]1CCSc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C22H29NO4S2/c1-3-4-5-6-12-22(2,27)13-7-8-16-9-10-19(24)17(16)11-14-28-21-23-18(15-29-21)20(25)26/h7-8,15-17,27H,3-5,9-11,13-14H2,1-2H3,(H,25,26)/t16-,17+,22-/m0/s1 |
| InChIKey | OOQJMVKVKJZZGG-JKSBSHDWSA-N |
| XLogP | 4.81 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|