C21H30FNO4S2 — CID 67082678
2-[2-[(1R,2S)-2-[(E)-9-fluoro-4-hydroxy-4-methylnon-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 67082678) has the molecular formula C21H30FNO4S2 and a molecular weight of 443.61 g/mol. Its IUPAC name is 2-[2-[(1R,2S)-2-[(E)-9-fluoro-4-hydroxy-4-methylnon-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(1R,2S)-2-[(E)-9-fluoro-4-hydroxy-4-methylnon-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67082678 |
| Molecular Formula | C21H30FNO4S2 |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-[2-[(1R,2S)-2-[(E)-9-fluoro-4-hydroxy-4-methylnon-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(O)(C/C=C/[C@@H]1CCC(=O)[C@@H]1CCSc1nc(C(=O)O)cs1)CCCCCF |
| InChI | InChI=1S/C21H30FNO4S2/c1-21(27,10-3-2-4-12-22)11-5-6-15-7-8-18(24)16(15)9-13-28-20-23-17(14-29-20)19(25)26/h5-6,14-16,27H,2-4,7-13H2,1H3,(H,25,26)/b6-5+/t15-,16-,21?/m1/s1 |
| InChIKey | OVRFXBBSVQBLPG-CRVSWENESA-N |
| XLogP | 5.15 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|