C20H24F3NO4S2 — CID 67127557
2-[2-[(1R)-2-oxo-5-[(1E,4R)-7,8,8-trifluoro-4-hydroxy-4-methylocta-1,7-dienyl]cyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 67127557) has the molecular formula C20H24F3NO4S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[2-[(1R)-2-oxo-5-[(1E,4R)-7,8,8-trifluoro-4-hydroxy-4-methylocta-1,7-dienyl]cyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(1R)-2-oxo-5-[(1E,4R)-7,8,8-trifluoro-4-hydroxy-4-methylocta-1,7-dienyl]cyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67127557 |
| Molecular Formula | C20H24F3NO4S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-[2-[(1R)-2-oxo-5-[(1E,4R)-7,8,8-trifluoro-4-hydroxy-4-methylocta-1,7-dienyl]cyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C[C@](O)(C/C=C/C1CCC(=O)[C@@H]1CCSc1nc(C(=O)O)cs1)CCC(F)=C(F)F |
| InChI | InChI=1S/C20H24F3NO4S2/c1-20(28,9-6-14(21)17(22)23)8-2-3-12-4-5-16(25)13(12)7-10-29-19-24-15(11-30-19)18(26)27/h2-3,11-13,28H,4-10H2,1H3,(H,26,27)/b3-2+/t12?,13-,20+/m1/s1 |
| InChIKey | FXVDFPWMKDFSDI-VHUMJWGNSA-N |
| XLogP | 5.47 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|