C22H35AgO5 — CID 88709961
silver (E)-7-[(1R,2R)-2-[(E)-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-1,3-dihydroxy-1-oxohept-2-en-2-olate (PubChem CID 88709961) has the molecular formula C22H35AgO5 and a molecular weight of 487.39 g/mol. Its IUPAC name is silver (E)-7-[(1R,2R)-2-[(E)-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-1,3-dihydroxy-1-oxohept-2-en-2-olate.
| Compound Name | silver (E)-7-[(1R,2R)-2-[(E)-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-1,3-dihydroxy-1-oxohept-2-en-2-olate |
|---|---|
| PubChem CID | 88709961 |
| Molecular Formula | C22H35AgO5 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | silver (E)-7-[(1R,2R)-2-[(E)-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-1,3-dihydroxy-1-oxohept-2-en-2-olate |
| SMILES | CCCCC(C)(C)C/C=C/[C@H]1CCC(=O)[C@@H]1CCCC/C(O)=C(\[O-])C(=O)O.[Ag+] |
| InChI | InChI=1S/C22H36O5.Ag/c1-4-5-14-22(2,3)15-8-9-16-12-13-18(23)17(16)10-6-7-11-19(24)20(25)21(26)27;/h8-9,16-17,24-25H,4-7,10-15H2,1-3H3,(H,26,27);/q;+1/p-1/b9-8+,20-19+;/t16-,17+;/m0./s1 |
| InChIKey | AJXLYTQQSBDBGK-KRINVYSISA-M |
| XLogP | 4.52 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|