C25H42O5S — CID 57171160
7-[(1R,2R)-2-(4-cyclopropyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]-2-(2-hydroxyethylsulfanyl)heptanoic acid (PubChem CID 57171160) has the molecular formula C25H42O5S and a molecular weight of 454.67 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(4-cyclopropyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]-2-(2-hydroxyethylsulfanyl)heptanoic acid.
| Compound Name | 7-[(1R,2R)-2-(4-cyclopropyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]-2-(2-hydroxyethylsulfanyl)heptanoic acid |
|---|---|
| PubChem CID | 57171160 |
| Molecular Formula | C25H42O5S |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 7-[(1R,2R)-2-(4-cyclopropyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]-2-(2-hydroxyethylsulfanyl)heptanoic acid |
| SMILES | CCCCC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(SCCO)C(=O)O)C1CC1 |
| InChI | InChI=1S/C25H42O5S/c1-2-3-15-25(30,20-12-13-20)16-7-8-19-11-14-22(27)21(19)9-5-4-6-10-23(24(28)29)31-18-17-26/h7-8,19-21,23,26,30H,2-6,9-18H2,1H3,(H,28,29)/t19-,21+,23?,25?/m0/s1 |
| InChIKey | OSRIDTVFONDFPV-KSNRECHZSA-N |
| XLogP | 4.99 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|