C28H42O4 — CID 90672526
7-[(1R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-2-phenylheptanoic acid (PubChem CID 90672526) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is 7-[(1R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-2-phenylheptanoic acid.
| Compound Name | 7-[(1R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-2-phenylheptanoic acid |
|---|---|
| PubChem CID | 90672526 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 7-[(1R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-2-phenylheptanoic acid |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/C1CCC(=O)[C@@H]1CCCCCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C28H42O4/c1-4-5-20-28(2,3)26(30)19-17-22-16-18-25(29)23(22)14-10-7-11-15-24(27(31)32)21-12-8-6-9-13-21/h6,8-9,12-13,17,19,22-24,26,30H,4-5,7,10-11,14-16,18,20H2,1-3H3,(H,31,32)/b19-17+/t22?,23-,24?,26-/m1/s1 |
| InChIKey | PSXVYMRLNXSUKQ-FXMQJTLFSA-N |
| XLogP | 6.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|