C26H42O2 — CID 22788984
7-[(1S,2S)-2-octylcyclopentyl]-2-phenylheptanoic acid (PubChem CID 22788984) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 7-[(1S,2S)-2-octylcyclopentyl]-2-phenylheptanoic acid.
| Compound Name | 7-[(1S,2S)-2-octylcyclopentyl]-2-phenylheptanoic acid |
|---|---|
| PubChem CID | 22788984 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 7-[(1S,2S)-2-octylcyclopentyl]-2-phenylheptanoic acid |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1CCCCCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C26H42O2/c1-2-3-4-5-6-9-15-22-19-14-20-23(22)16-10-8-13-21-25(26(27)28)24-17-11-7-12-18-24/h7,11-12,17-18,22-23,25H,2-6,8-10,13-16,19-21H2,1H3,(H,27,28)/t22-,23-,25?/m0/s1 |
| InChIKey | ZARLIPLIVXLVLZ-REQUTJCGSA-N |
| XLogP | 7.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|