C28H44O5 — CID 163637738
7-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxydecyl)-5-oxocyclopentyl]-2-phenylheptanoic acid (PubChem CID 163637738) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxydecyl)-5-oxocyclopentyl]-2-phenylheptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxydecyl)-5-oxocyclopentyl]-2-phenylheptanoic acid |
|---|---|
| PubChem CID | 163637738 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | 7-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxydecyl)-5-oxocyclopentyl]-2-phenylheptanoic acid |
| SMILES | CCCCCCC(O)CCC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C28H44O5/c1-2-3-4-9-15-22(29)16-12-19-25-24(26(30)20-27(25)31)18-11-6-10-17-23(28(32)33)21-13-7-5-8-14-21/h5,7-8,13-14,22-25,27,29,31H,2-4,6,9-12,15-20H2,1H3,(H,32,33)/t22?,23?,24-,25-,27-/m1/s1 |
| InChIKey | IBQJQKLCMFCORS-ZUOHBRCJSA-N |
| XLogP | 5.87 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|